C17H12Cl2N6O4 — CID 169021755
2-[3,5-dichloro-4-[4-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)-5-hydroxypyrimidin-2-yl]oxyphenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile (PubChem CID 169021755) has the molecular formula C17H12Cl2N6O4 and a molecular weight of 441.26 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[4-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)-5-hydroxypyrimidin-2-yl]oxyphenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile.
| Compound Name | 2-[3,5-dichloro-4-[4-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)-5-hydroxypyrimidin-2-yl]oxyphenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
|---|---|
| PubChem CID | 169021755 |
| Molecular Formula | C17H12Cl2N6O4 |
| Molecular Weight | 441.26 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 2-[3,5-dichloro-4-[4-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)-5-hydroxypyrimidin-2-yl]oxyphenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
| SMILES | [2H]C([2H])([2H])C(c1nc(Oc2c(Cl)cc(-n3nc(C#N)c(=O)[nH]c3=O)cc2Cl)ncc1O)C([2H])([2H])[2H] |
| InChI | InChI=1S/C17H12Cl2N6O4/c1-7(2)13-12(26)6-21-16(22-13)29-14-9(18)3-8(4-10(14)19)25-17(28)23-15(27)11(5-20)24-25/h3-4,6-7,26H,1-2H3,(H,23,27,28)/i1D3,2D3 |
| InChIKey | DOTKORZMXOFEGM-WFGJKAKNSA-N |
| XLogP | 2.51 |
| TPSA | 146.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |