C21H27N7O3S — CID 16902304
N-[2-[6-ethylsulfanyl-4-(2-methylpropylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2-methyl-3-nitrobenzamide (PubChem CID 16902304) has the molecular formula C21H27N7O3S and a molecular weight of 457.56 g/mol. Its IUPAC name is N-[2-[6-ethylsulfanyl-4-(2-methylpropylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2-methyl-3-nitrobenzamide.
| Compound Name | N-[2-[6-ethylsulfanyl-4-(2-methylpropylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 16902304 |
| Molecular Formula | C21H27N7O3S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | N-[2-[6-ethylsulfanyl-4-(2-methylpropylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2-methyl-3-nitrobenzamide |
| SMILES | CCSc1nc(NCC(C)C)c2cnn(CCNC(=O)c3cccc([N+](=O)[O-])c3C)c2n1 |
| InChI | InChI=1S/C21H27N7O3S/c1-5-32-21-25-18(23-11-13(2)3)16-12-24-27(19(16)26-21)10-9-22-20(29)15-7-6-8-17(14(15)4)28(30)31/h6-8,12-13H,5,9-11H2,1-4H3,(H,22,29)(H,23,25,26) |
| InChIKey | LOCMBYOCUFRXEC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|