C21H26N6O4S — CID 16902532
methyl 2-[2-[6-ethylsulfanyl-4-(2-methoxyethylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethylcarbamoyl]benzoate (PubChem CID 16902532) has the molecular formula C21H26N6O4S and a molecular weight of 458.54 g/mol. Its IUPAC name is methyl 2-[2-[6-ethylsulfanyl-4-(2-methoxyethylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethylcarbamoyl]benzoate.
| Compound Name | methyl 2-[2-[6-ethylsulfanyl-4-(2-methoxyethylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 16902532 |
| Molecular Formula | C21H26N6O4S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | methyl 2-[2-[6-ethylsulfanyl-4-(2-methoxyethylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethylcarbamoyl]benzoate |
| SMILES | CCSc1nc(NCCOC)c2cnn(CCNC(=O)c3ccccc3C(=O)OC)c2n1 |
| InChI | InChI=1S/C21H26N6O4S/c1-4-32-21-25-17(22-10-12-30-2)16-13-24-27(18(16)26-21)11-9-23-19(28)14-7-5-6-8-15(14)20(29)31-3/h5-8,13H,4,9-12H2,1-3H3,(H,23,28)(H,22,25,26) |
| InChIKey | JFYAYAKCLLNLKN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|