C21H28N6O2S2 — CID 16902524
2-ethylsulfanyl-N-[2-[6-ethylsulfanyl-4-(2-methoxyethylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]benzamide (PubChem CID 16902524) has the molecular formula C21H28N6O2S2 and a molecular weight of 460.63 g/mol. Its IUPAC name is 2-ethylsulfanyl-N-[2-[6-ethylsulfanyl-4-(2-methoxyethylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]benzamide.
| Compound Name | 2-ethylsulfanyl-N-[2-[6-ethylsulfanyl-4-(2-methoxyethylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 16902524 |
| Molecular Formula | C21H28N6O2S2 |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 2-ethylsulfanyl-N-[2-[6-ethylsulfanyl-4-(2-methoxyethylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]benzamide |
| SMILES | CCSc1nc(NCCOC)c2cnn(CCNC(=O)c3ccccc3SCC)c2n1 |
| InChI | InChI=1S/C21H28N6O2S2/c1-4-30-17-9-7-6-8-15(17)20(28)23-10-12-27-19-16(14-24-27)18(22-11-13-29-3)25-21(26-19)31-5-2/h6-9,14H,4-5,10-13H2,1-3H3,(H,23,28)(H,22,25,26) |
| InChIKey | IPUHNINHCKNWKE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|