C20H25ClN6O3S — CID 16902470
2-(4-chlorophenoxy)-N-[2-[6-ethylsulfanyl-4-(2-methoxyethylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]acetamide (PubChem CID 16902470) has the molecular formula C20H25ClN6O3S and a molecular weight of 464.98 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[2-[6-ethylsulfanyl-4-(2-methoxyethylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[2-[6-ethylsulfanyl-4-(2-methoxyethylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 16902470 |
| Molecular Formula | C20H25ClN6O3S |
| Molecular Weight | 464.98 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[2-[6-ethylsulfanyl-4-(2-methoxyethylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]acetamide |
| SMILES | CCSc1nc(NCCOC)c2cnn(CCNC(=O)COc3ccc(Cl)cc3)c2n1 |
| InChI | InChI=1S/C20H25ClN6O3S/c1-3-31-20-25-18(23-9-11-29-2)16-12-24-27(19(16)26-20)10-8-22-17(28)13-30-15-6-4-14(21)5-7-15/h4-7,12H,3,8-11,13H2,1-2H3,(H,22,28)(H,23,25,26) |
| InChIKey | CZNSMTDNTHFVOR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.98 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|