C16H26N6O3S — CID 16903591
2-methoxy-N-[2-[4-(2-methoxyethylamino)-6-propylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]acetamide (PubChem CID 16903591) has the molecular formula C16H26N6O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is 2-methoxy-N-[2-[4-(2-methoxyethylamino)-6-propylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]acetamide.
| Compound Name | 2-methoxy-N-[2-[4-(2-methoxyethylamino)-6-propylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 16903591 |
| Molecular Formula | C16H26N6O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 2-methoxy-N-[2-[4-(2-methoxyethylamino)-6-propylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]acetamide |
| SMILES | CCCSc1nc(NCCOC)c2cnn(CCNC(=O)COC)c2n1 |
| InChI | InChI=1S/C16H26N6O3S/c1-4-9-26-16-20-14(18-6-8-24-2)12-10-19-22(15(12)21-16)7-5-17-13(23)11-25-3/h10H,4-9,11H2,1-3H3,(H,17,23)(H,18,20,21) |
| InChIKey | AVKMZSOMNPHQPD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|