C15H23ClN6OS — CID 16903145
2-chloro-N-[2-[4-(propylamino)-6-propylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]acetamide (PubChem CID 16903145) has the molecular formula C15H23ClN6OS and a molecular weight of 370.91 g/mol. Its IUPAC name is 2-chloro-N-[2-[4-(propylamino)-6-propylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]acetamide.
| Compound Name | 2-chloro-N-[2-[4-(propylamino)-6-propylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 16903145 |
| Molecular Formula | C15H23ClN6OS |
| Molecular Weight | 370.91 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 2-chloro-N-[2-[4-(propylamino)-6-propylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]acetamide |
| SMILES | CCCNc1nc(SCCC)nc2c1cnn2CCNC(=O)CCl |
| InChI | InChI=1S/C15H23ClN6OS/c1-3-5-18-13-11-10-19-22(7-6-17-12(23)9-16)14(11)21-15(20-13)24-8-4-2/h10H,3-9H2,1-2H3,(H,17,23)(H,18,20,21) |
| InChIKey | ASHZZQQQVGTLCK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.91 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|