C17H27ClN6O2S — CID 16903741
3-chloro-N-[2-[4-(2-ethoxyethylamino)-6-propylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]propanamide (PubChem CID 16903741) has the molecular formula C17H27ClN6O2S and a molecular weight of 414.96 g/mol. Its IUPAC name is 3-chloro-N-[2-[4-(2-ethoxyethylamino)-6-propylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]propanamide.
| Compound Name | 3-chloro-N-[2-[4-(2-ethoxyethylamino)-6-propylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 16903741 |
| Molecular Formula | C17H27ClN6O2S |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 3-chloro-N-[2-[4-(2-ethoxyethylamino)-6-propylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]propanamide |
| SMILES | CCCSc1nc(NCCOCC)c2cnn(CCNC(=O)CCCl)c2n1 |
| InChI | InChI=1S/C17H27ClN6O2S/c1-3-11-27-17-22-15(20-8-10-26-4-2)13-12-21-24(16(13)23-17)9-7-19-14(25)5-6-18/h12H,3-11H2,1-2H3,(H,19,25)(H,20,22,23) |
| InChIKey | MJMJKIURRANDEE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|