C22H27F3N6O2S — CID 16903791
N-[2-[4-(2-ethoxyethylamino)-6-propylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-3-(trifluoromethyl)benzamide (PubChem CID 16903791) has the molecular formula C22H27F3N6O2S and a molecular weight of 496.56 g/mol. Its IUPAC name is N-[2-[4-(2-ethoxyethylamino)-6-propylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[4-(2-ethoxyethylamino)-6-propylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 16903791 |
| Molecular Formula | C22H27F3N6O2S |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | N-[2-[4-(2-ethoxyethylamino)-6-propylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-3-(trifluoromethyl)benzamide |
| SMILES | CCCSc1nc(NCCOCC)c2cnn(CCNC(=O)c3cccc(C(F)(F)F)c3)c2n1 |
| InChI | InChI=1S/C22H27F3N6O2S/c1-3-12-34-21-29-18(26-9-11-33-4-2)17-14-28-31(19(17)30-21)10-8-27-20(32)15-6-5-7-16(13-15)22(23,24)25/h5-7,13-14H,3-4,8-12H2,1-2H3,(H,27,32)(H,26,29,30) |
| InChIKey | DDZHFFNIVBIXDP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|