C21H27N7O4S — CID 16904954
N-[2-[4-(2-ethoxyethylamino)-6-propan-2-ylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-3-nitrobenzamide (PubChem CID 16904954) has the molecular formula C21H27N7O4S and a molecular weight of 473.56 g/mol. Its IUPAC name is N-[2-[4-(2-ethoxyethylamino)-6-propan-2-ylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-3-nitrobenzamide.
| Compound Name | N-[2-[4-(2-ethoxyethylamino)-6-propan-2-ylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 16904954 |
| Molecular Formula | C21H27N7O4S |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | N-[2-[4-(2-ethoxyethylamino)-6-propan-2-ylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-3-nitrobenzamide |
| SMILES | CCOCCNc1nc(SC(C)C)nc2c1cnn2CCNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H27N7O4S/c1-4-32-11-9-22-18-17-13-24-27(19(17)26-21(25-18)33-14(2)3)10-8-23-20(29)15-6-5-7-16(12-15)28(30)31/h5-7,12-14H,4,8-11H2,1-3H3,(H,23,29)(H,22,25,26) |
| InChIKey | WHCWCQMDYFTASK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|