C20H25N7O3S — CID 16904362
3-nitro-N-[2-[6-propan-2-ylsulfanyl-4-(propylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]benzamide (PubChem CID 16904362) has the molecular formula C20H25N7O3S and a molecular weight of 443.53 g/mol. Its IUPAC name is 3-nitro-N-[2-[6-propan-2-ylsulfanyl-4-(propylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]benzamide.
| Compound Name | 3-nitro-N-[2-[6-propan-2-ylsulfanyl-4-(propylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 16904362 |
| Molecular Formula | C20H25N7O3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 3-nitro-N-[2-[6-propan-2-ylsulfanyl-4-(propylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]benzamide |
| SMILES | CCCNc1nc(SC(C)C)nc2c1cnn2CCNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H25N7O3S/c1-4-8-21-17-16-12-23-26(18(16)25-20(24-17)31-13(2)3)10-9-22-19(28)14-6-5-7-15(11-14)27(29)30/h5-7,11-13H,4,8-10H2,1-3H3,(H,22,28)(H,21,24,25) |
| InChIKey | KBVUVQOCDVZQTR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|