C21H28N6O2S — CID 16904771
N-[2-[4-(2-methoxyethylamino)-6-propan-2-ylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-3-methylbenzamide (PubChem CID 16904771) has the molecular formula C21H28N6O2S and a molecular weight of 428.56 g/mol. Its IUPAC name is N-[2-[4-(2-methoxyethylamino)-6-propan-2-ylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-3-methylbenzamide.
| Compound Name | N-[2-[4-(2-methoxyethylamino)-6-propan-2-ylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 16904771 |
| Molecular Formula | C21H28N6O2S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | N-[2-[4-(2-methoxyethylamino)-6-propan-2-ylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-3-methylbenzamide |
| SMILES | COCCNc1nc(SC(C)C)nc2c1cnn2CCNC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C21H28N6O2S/c1-14(2)30-21-25-18(22-9-11-29-4)17-13-24-27(19(17)26-21)10-8-23-20(28)16-7-5-6-15(3)12-16/h5-7,12-14H,8-11H2,1-4H3,(H,23,28)(H,22,25,26) |
| InChIKey | RNKTZESWHGLDEX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|