C20H24Cl2N6O2S — CID 16904804
2,5-dichloro-N-[2-[4-(2-methoxyethylamino)-6-propan-2-ylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]benzamide (PubChem CID 16904804) has the molecular formula C20H24Cl2N6O2S and a molecular weight of 483.43 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-[4-(2-methoxyethylamino)-6-propan-2-ylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]benzamide.
| Compound Name | 2,5-dichloro-N-[2-[4-(2-methoxyethylamino)-6-propan-2-ylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 16904804 |
| Molecular Formula | C20H24Cl2N6O2S |
| Molecular Weight | 483.43 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | 2,5-dichloro-N-[2-[4-(2-methoxyethylamino)-6-propan-2-ylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]benzamide |
| SMILES | COCCNc1nc(SC(C)C)nc2c1cnn2CCNC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C20H24Cl2N6O2S/c1-12(2)31-20-26-17(23-7-9-30-3)15-11-25-28(18(15)27-20)8-6-24-19(29)14-10-13(21)4-5-16(14)22/h4-5,10-12H,6-9H2,1-3H3,(H,24,29)(H,23,26,27) |
| InChIKey | PUKFSEHHZDPUMC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|