C18H29ClN6O2S — CID 16904768
3-chloro-N-[2-[4-(2-methoxyethylamino)-6-propan-2-ylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2,2-dimethylpropanamide (PubChem CID 16904768) has the molecular formula C18H29ClN6O2S and a molecular weight of 428.99 g/mol. Its IUPAC name is 3-chloro-N-[2-[4-(2-methoxyethylamino)-6-propan-2-ylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[2-[4-(2-methoxyethylamino)-6-propan-2-ylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 16904768 |
| Molecular Formula | C18H29ClN6O2S |
| Molecular Weight | 428.99 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 3-chloro-N-[2-[4-(2-methoxyethylamino)-6-propan-2-ylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2,2-dimethylpropanamide |
| SMILES | COCCNc1nc(SC(C)C)nc2c1cnn2CCNC(=O)C(C)(C)CCl |
| InChI | InChI=1S/C18H29ClN6O2S/c1-12(2)28-17-23-14(20-7-9-27-5)13-10-22-25(15(13)24-17)8-6-21-16(26)18(3,4)11-19/h10,12H,6-9,11H2,1-5H3,(H,21,26)(H,20,23,24) |
| InChIKey | VGNFYDXPFLBKCM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.99 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|