C25H34N6O5S — CID 16904826
(Z)-N-[2-[4-(2-methoxyethylamino)-6-propan-2-ylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 16904826) has the molecular formula C25H34N6O5S and a molecular weight of 530.65 g/mol. Its IUPAC name is (Z)-N-[2-[4-(2-methoxyethylamino)-6-propan-2-ylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-N-[2-[4-(2-methoxyethylamino)-6-propan-2-ylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 16904826 |
| Molecular Formula | C25H34N6O5S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | (Z)-N-[2-[4-(2-methoxyethylamino)-6-propan-2-ylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COCCNc1nc(SC(C)C)nc2c1cnn2CCNC(=O)/C=C\c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C25H34N6O5S/c1-16(2)37-25-29-23(27-10-12-33-3)18-15-28-31(24(18)30-25)11-9-26-21(32)8-7-17-13-19(34-4)22(36-6)20(14-17)35-5/h7-8,13-16H,9-12H2,1-6H3,(H,26,32)(H,27,29,30)/b8-7- |
| InChIKey | YPZYSXCPHLVILP-FPLPWBNLSA-N |
| XLogP | 3.24 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|