C22H28N6O4S — CID 73339644
3-(3,4-dimethoxyphenyl)-N-[2-[4-(2-methoxyethylamino)-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]prop-2-enamide (PubChem CID 73339644) has the molecular formula C22H28N6O4S and a molecular weight of 472.57 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[2-[4-(2-methoxyethylamino)-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]prop-2-enamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[2-[4-(2-methoxyethylamino)-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 73339644 |
| Molecular Formula | C22H28N6O4S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[2-[4-(2-methoxyethylamino)-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]prop-2-enamide |
| SMILES | COCCNc1nc(SC)nc2c1cnn2CCNC(=O)C=Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C22H28N6O4S/c1-30-12-10-24-20-16-14-25-28(21(16)27-22(26-20)33-4)11-9-23-19(29)8-6-15-5-7-17(31-2)18(13-15)32-3/h5-8,13-14H,9-12H2,1-4H3,(H,23,29)(H,24,26,27) |
| InChIKey | YKJOQVAFDSZOJX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 112.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|