C22H30N6O2S — CID 16903680
N-[2-[4-(2-methoxyethylamino)-6-propylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2-(3-methylphenyl)acetamide (PubChem CID 16903680) has the molecular formula C22H30N6O2S and a molecular weight of 442.59 g/mol. Its IUPAC name is N-[2-[4-(2-methoxyethylamino)-6-propylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2-(3-methylphenyl)acetamide.
| Compound Name | N-[2-[4-(2-methoxyethylamino)-6-propylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 16903680 |
| Molecular Formula | C22H30N6O2S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | N-[2-[4-(2-methoxyethylamino)-6-propylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2-(3-methylphenyl)acetamide |
| SMILES | CCCSc1nc(NCCOC)c2cnn(CCNC(=O)Cc3cccc(C)c3)c2n1 |
| InChI | InChI=1S/C22H30N6O2S/c1-4-12-31-22-26-20(24-9-11-30-3)18-15-25-28(21(18)27-22)10-8-23-19(29)14-17-7-5-6-16(2)13-17/h5-7,13,15H,4,8-12,14H2,1-3H3,(H,23,29)(H,24,26,27) |
| InChIKey | CAFUCHKQHOOJKF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|