C20H25FN6O2S — CID 16903622
4-fluoro-N-[2-[4-(2-methoxyethylamino)-6-propylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]benzamide (PubChem CID 16903622) has the molecular formula C20H25FN6O2S and a molecular weight of 432.53 g/mol. Its IUPAC name is 4-fluoro-N-[2-[4-(2-methoxyethylamino)-6-propylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]benzamide.
| Compound Name | 4-fluoro-N-[2-[4-(2-methoxyethylamino)-6-propylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 16903622 |
| Molecular Formula | C20H25FN6O2S |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 4-fluoro-N-[2-[4-(2-methoxyethylamino)-6-propylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]benzamide |
| SMILES | CCCSc1nc(NCCOC)c2cnn(CCNC(=O)c3ccc(F)cc3)c2n1 |
| InChI | InChI=1S/C20H25FN6O2S/c1-3-12-30-20-25-17(22-9-11-29-2)16-13-24-27(18(16)26-20)10-8-23-19(28)14-4-6-15(21)7-5-14/h4-7,13H,3,8-12H2,1-2H3,(H,23,28)(H,22,25,26) |
| InChIKey | GSJXYENEJCCYJY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|