C18H30N6O3S — CID 16904910
2-ethoxy-N-[2-[4-(2-ethoxyethylamino)-6-propan-2-ylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]acetamide (PubChem CID 16904910) has the molecular formula C18H30N6O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is 2-ethoxy-N-[2-[4-(2-ethoxyethylamino)-6-propan-2-ylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]acetamide.
| Compound Name | 2-ethoxy-N-[2-[4-(2-ethoxyethylamino)-6-propan-2-ylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 16904910 |
| Molecular Formula | C18H30N6O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 2-ethoxy-N-[2-[4-(2-ethoxyethylamino)-6-propan-2-ylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]acetamide |
| SMILES | CCOCCNc1nc(SC(C)C)nc2c1cnn2CCNC(=O)COCC |
| InChI | InChI=1S/C18H30N6O3S/c1-5-26-10-8-20-16-14-11-21-24(9-7-19-15(25)12-27-6-2)17(14)23-18(22-16)28-13(3)4/h11,13H,5-10,12H2,1-4H3,(H,19,25)(H,20,22,23) |
| InChIKey | HDWIPYYUBWGRAN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|