C20H34N6O2S — CID 16901362
N-[2-[4-(2-ethoxyethylamino)-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2-propylpentanamide (PubChem CID 16901362) has the molecular formula C20H34N6O2S and a molecular weight of 422.60 g/mol. Its IUPAC name is N-[2-[4-(2-ethoxyethylamino)-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2-propylpentanamide.
| Compound Name | N-[2-[4-(2-ethoxyethylamino)-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2-propylpentanamide |
|---|---|
| PubChem CID | 16901362 |
| Molecular Formula | C20H34N6O2S |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | N-[2-[4-(2-ethoxyethylamino)-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2-propylpentanamide |
| SMILES | CCCC(CCC)C(=O)NCCn1ncc2c(NCCOCC)nc(SC)nc21 |
| InChI | InChI=1S/C20H34N6O2S/c1-5-8-15(9-6-2)19(27)22-10-12-26-18-16(14-23-26)17(21-11-13-28-7-3)24-20(25-18)29-4/h14-15H,5-13H2,1-4H3,(H,22,27)(H,21,24,25) |
| InChIKey | WCGZQSRJLDUQCQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|