C21H28N6O4S — CID 16901396
N-[2-[4-(2-ethoxyethylamino)-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2,3-dimethoxybenzamide (PubChem CID 16901396) has the molecular formula C21H28N6O4S and a molecular weight of 460.56 g/mol. Its IUPAC name is N-[2-[4-(2-ethoxyethylamino)-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2,3-dimethoxybenzamide.
| Compound Name | N-[2-[4-(2-ethoxyethylamino)-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 16901396 |
| Molecular Formula | C21H28N6O4S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | N-[2-[4-(2-ethoxyethylamino)-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2,3-dimethoxybenzamide |
| SMILES | CCOCCNc1nc(SC)nc2c1cnn2CCNC(=O)c1cccc(OC)c1OC |
| InChI | InChI=1S/C21H28N6O4S/c1-5-31-12-10-22-18-15-13-24-27(19(15)26-21(25-18)32-4)11-9-23-20(28)14-7-6-8-16(29-2)17(14)30-3/h6-8,13H,5,9-12H2,1-4H3,(H,23,28)(H,22,25,26) |
| InChIKey | DXINBLPRAQYXMY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 112.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|