C22H29N7O6S — CID 16902666
N-[2-[4-(2-ethoxyethylamino)-6-ethylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-4,5-dimethoxy-2-nitrobenzamide (PubChem CID 16902666) has the molecular formula C22H29N7O6S and a molecular weight of 519.58 g/mol. Its IUPAC name is N-[2-[4-(2-ethoxyethylamino)-6-ethylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-4,5-dimethoxy-2-nitrobenzamide.
| Compound Name | N-[2-[4-(2-ethoxyethylamino)-6-ethylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-4,5-dimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 16902666 |
| Molecular Formula | C22H29N7O6S |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | N-[2-[4-(2-ethoxyethylamino)-6-ethylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-4,5-dimethoxy-2-nitrobenzamide |
| SMILES | CCOCCNc1nc(SCC)nc2c1cnn2CCNC(=O)c1cc(OC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H29N7O6S/c1-5-35-10-8-23-19-15-13-25-28(20(15)27-22(26-19)36-6-2)9-7-24-21(30)14-11-17(33-3)18(34-4)12-16(14)29(31)32/h11-13H,5-10H2,1-4H3,(H,24,30)(H,23,26,27) |
| InChIKey | XGNCCCUVCQDAGL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 155.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|