C22H30N6O2S — CID 16902564
N-[2-[4-(2-ethoxyethylamino)-6-ethylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-3,5-dimethylbenzamide (PubChem CID 16902564) has the molecular formula C22H30N6O2S and a molecular weight of 442.59 g/mol. Its IUPAC name is N-[2-[4-(2-ethoxyethylamino)-6-ethylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-3,5-dimethylbenzamide.
| Compound Name | N-[2-[4-(2-ethoxyethylamino)-6-ethylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 16902564 |
| Molecular Formula | C22H30N6O2S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | N-[2-[4-(2-ethoxyethylamino)-6-ethylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-3,5-dimethylbenzamide |
| SMILES | CCOCCNc1nc(SCC)nc2c1cnn2CCNC(=O)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C22H30N6O2S/c1-5-30-10-8-23-19-18-14-25-28(20(18)27-22(26-19)31-6-2)9-7-24-21(29)17-12-15(3)11-16(4)13-17/h11-14H,5-10H2,1-4H3,(H,24,29)(H,23,26,27) |
| InChIKey | GOVIEEBXIUCLFP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|