C18H23BrN6O3S — CID 16902654
5-bromo-N-[2-[4-(2-ethoxyethylamino)-6-ethylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]furan-2-carboxamide (PubChem CID 16902654) has the molecular formula C18H23BrN6O3S and a molecular weight of 483.39 g/mol. Its IUPAC name is 5-bromo-N-[2-[4-(2-ethoxyethylamino)-6-ethylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[2-[4-(2-ethoxyethylamino)-6-ethylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 16902654 |
| Molecular Formula | C18H23BrN6O3S |
| Molecular Weight | 483.39 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | 5-bromo-N-[2-[4-(2-ethoxyethylamino)-6-ethylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]furan-2-carboxamide |
| SMILES | CCOCCNc1nc(SCC)nc2c1cnn2CCNC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C18H23BrN6O3S/c1-3-27-10-8-20-15-12-11-22-25(16(12)24-18(23-15)29-4-2)9-7-21-17(26)13-5-6-14(19)28-13/h5-6,11H,3-4,7-10H2,1-2H3,(H,21,26)(H,20,23,24) |
| InChIKey | IYAURPRAACOPDT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|