C18H24N6O2S2 — CID 16902655
N-[2-[4-(2-ethoxyethylamino)-6-ethylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]thiophene-2-carboxamide (PubChem CID 16902655) has the molecular formula C18H24N6O2S2 and a molecular weight of 420.56 g/mol. Its IUPAC name is N-[2-[4-(2-ethoxyethylamino)-6-ethylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[4-(2-ethoxyethylamino)-6-ethylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 16902655 |
| Molecular Formula | C18H24N6O2S2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N-[2-[4-(2-ethoxyethylamino)-6-ethylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]thiophene-2-carboxamide |
| SMILES | CCOCCNc1nc(SCC)nc2c1cnn2CCNC(=O)c1cccs1 |
| InChI | InChI=1S/C18H24N6O2S2/c1-3-26-10-8-19-15-13-12-21-24(16(13)23-18(22-15)27-4-2)9-7-20-17(25)14-6-5-11-28-14/h5-6,11-12H,3-4,7-10H2,1-2H3,(H,20,25)(H,19,22,23) |
| InChIKey | ZNVHRYQRQNGWMC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|