C18H30N6O2S — CID 16902538
N-[2-[4-(2-ethoxyethylamino)-6-ethylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2,2-dimethylpropanamide (PubChem CID 16902538) has the molecular formula C18H30N6O2S and a molecular weight of 394.55 g/mol. Its IUPAC name is N-[2-[4-(2-ethoxyethylamino)-6-ethylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[4-(2-ethoxyethylamino)-6-ethylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 16902538 |
| Molecular Formula | C18H30N6O2S |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | N-[2-[4-(2-ethoxyethylamino)-6-ethylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2,2-dimethylpropanamide |
| SMILES | CCOCCNc1nc(SCC)nc2c1cnn2CCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H30N6O2S/c1-6-26-11-9-19-14-13-12-21-24(10-8-20-16(25)18(3,4)5)15(13)23-17(22-14)27-7-2/h12H,6-11H2,1-5H3,(H,20,25)(H,19,22,23) |
| InChIKey | ZAXXHSJRMRCWKM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|