C16H17N3O5 — CID 169024435
methyl 2-diazo-3-oxo-3-[(1R,2S)-2-(phenylmethoxycarbonylamino)cyclobutyl]propanoate (PubChem CID 169024435) has the molecular formula C16H17N3O5 and a molecular weight of 331.33 g/mol. Its IUPAC name is methyl 2-diazo-3-oxo-3-[(1R,2S)-2-(phenylmethoxycarbonylamino)cyclobutyl]propanoate.
| Compound Name | methyl 2-diazo-3-oxo-3-[(1R,2S)-2-(phenylmethoxycarbonylamino)cyclobutyl]propanoate |
|---|---|
| PubChem CID | 169024435 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | methyl 2-diazo-3-oxo-3-[(1R,2S)-2-(phenylmethoxycarbonylamino)cyclobutyl]propanoate |
| SMILES | COC(=O)C(=[N+]=[N-])C(=O)[C@@H]1CC[C@@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H17N3O5/c1-23-15(21)13(19-17)14(20)11-7-8-12(11)18-16(22)24-9-10-5-3-2-4-6-10/h2-6,11-12H,7-9H2,1H3,(H,18,22)/t11-,12+/m1/s1 |
| InChIKey | GFAXRLHVLDYSCY-NEPJUHHUSA-N |
| XLogP | 1.10 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|