C23H17F3N2O3 — CID 169024522
N-hydroxy-1-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]indole-6-carboxamide (PubChem CID 169024522) has the molecular formula C23H17F3N2O3 and a molecular weight of 426.39 g/mol. Its IUPAC name is N-hydroxy-1-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]indole-6-carboxamide.
| Compound Name | N-hydroxy-1-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]indole-6-carboxamide |
|---|---|
| PubChem CID | 169024522 |
| Molecular Formula | C23H17F3N2O3 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | N-hydroxy-1-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]indole-6-carboxamide |
| SMILES | O=C(NO)c1ccc2ccn(-c3ccc(OCc4ccc(C(F)(F)F)cc4)cc3)c2c1 |
| InChI | InChI=1S/C23H17F3N2O3/c24-23(25,26)18-5-1-15(2-6-18)14-31-20-9-7-19(8-10-20)28-12-11-16-3-4-17(13-21(16)28)22(29)27-30/h1-13,30H,14H2,(H,27,29) |
| InChIKey | VNWYVZOQKBZIHG-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|