C23H26N6O4 — CID 169025051
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-6-(2H-tetrazol-5-ylamino)hexanoic acid (PubChem CID 169025051) has the molecular formula C23H26N6O4 and a molecular weight of 450.50 g/mol. Its IUPAC name is (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-6-(2H-tetrazol-5-ylamino)hexanoic acid.
| Compound Name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-6-(2H-tetrazol-5-ylamino)hexanoic acid |
|---|---|
| PubChem CID | 169025051 |
| Molecular Formula | C23H26N6O4 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-6-(2H-tetrazol-5-ylamino)hexanoic acid |
| SMILES | CN(C(=O)OCC1c2ccccc2-c2ccccc21)[C@@H](CCCCNc1nn[nH]n1)C(=O)O |
| InChI | InChI=1S/C23H26N6O4/c1-29(20(21(30)31)12-6-7-13-24-22-25-27-28-26-22)23(32)33-14-19-17-10-4-2-8-15(17)16-9-3-5-11-18(16)19/h2-5,8-11,19-20H,6-7,12-14H2,1H3,(H,30,31)(H2,24,25,26,27,28)/t20-/m0/s1 |
| InChIKey | TUVONGPRUMZVTO-FQEVSTJZSA-N |
| XLogP | 3.12 |
| TPSA | 133.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|