C39H61N3O10Si — CID 169025210
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-6-[[methyl-[(2S,3R,4R,5R)-2,3,4,5-tetrahydroxy-6-tri(propan-2-yl)silyloxyhexyl]carbamoyl]amino]hexanoic acid (PubChem CID 169025210) has the molecular formula C39H61N3O10Si and a molecular weight of 760.01 g/mol. Its IUPAC name is (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-6-[[methyl-[(2S,3R,4R,5R)-2,3,4,5-tetrahydroxy-6-tri(propan-2-yl)silyloxyhexyl]carbamoyl]amino]hexanoic acid.
| Compound Name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-6-[[methyl-[(2S,3R,4R,5R)-2,3,4,5-tetrahydroxy-6-tri(propan-2-yl)silyloxyhexyl]carbamoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 169025210 |
| Molecular Formula | C39H61N3O10Si |
| Molecular Weight | 760.01 g/mol |
| Exact Mass | 759.41 |
| IUPAC Name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-6-[[methyl-[(2S,3R,4R,5R)-2,3,4,5-tetrahydroxy-6-tri(propan-2-yl)silyloxyhexyl]carbamoyl]amino]hexanoic acid |
| SMILES | CC(C)[Si](OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CN(C)C(=O)NCCCC[C@@H](C(=O)O)N(C)C(=O)OCC1c2ccccc2-c2ccccc21)(C(C)C)C(C)C |
| InChI | InChI=1S/C39H61N3O10Si/c1-24(2)53(25(3)4,26(5)6)52-23-34(44)36(46)35(45)33(43)21-41(7)38(49)40-20-14-13-19-32(37(47)48)42(8)39(50)51-22-31-29-17-11-9-15-27(29)28-16-10-12-18-30(28)31/h9-12,15-18,24-26,31-36,43-46H,13-14,19-23H2,1-8H3,(H,40,49)(H,47,48)/t32-,33-,34+,35+,36+/m0/s1 |
| InChIKey | FVGGWERGMRIXOK-JFKVGHNISA-N |
| XLogP | 4.77 |
| TPSA | 189.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.01 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|