C15H20N2O2 — CID 169026678
(2R)-5-[(hydroxyamino)methyl]-1'-methylspiro[1,3-dihydroindene-2,3'-piperidine]-2'-one (PubChem CID 169026678) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is (2R)-5-[(hydroxyamino)methyl]-1'-methylspiro[1,3-dihydroindene-2,3'-piperidine]-2'-one.
| Compound Name | (2R)-5-[(hydroxyamino)methyl]-1'-methylspiro[1,3-dihydroindene-2,3'-piperidine]-2'-one |
|---|---|
| PubChem CID | 169026678 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | (2R)-5-[(hydroxyamino)methyl]-1'-methylspiro[1,3-dihydroindene-2,3'-piperidine]-2'-one |
| SMILES | CN1CCC[C@]2(Cc3ccc(CNO)cc3C2)C1=O |
| InChI | InChI=1S/C15H20N2O2/c1-17-6-2-5-15(14(17)18)8-12-4-3-11(10-16-19)7-13(12)9-15/h3-4,7,16,19H,2,5-6,8-10H2,1H3/t15-/m1/s1 |
| InChIKey | OLWYUXOREYBMSD-OAHLLOKOSA-N |
| XLogP | 1.50 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|