C9H13F2NO2 — CID 169028206
4-(1,1-difluoro-2-methylpropyl)piperidine-2,6-dione (PubChem CID 169028206) has the molecular formula C9H13F2NO2 and a molecular weight of 205.20 g/mol. Its IUPAC name is 4-(1,1-difluoro-2-methylpropyl)piperidine-2,6-dione.
| Compound Name | 4-(1,1-difluoro-2-methylpropyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 169028206 |
| Molecular Formula | C9H13F2NO2 |
| Molecular Weight | 205.20 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 4-(1,1-difluoro-2-methylpropyl)piperidine-2,6-dione |
| SMILES | CC(C)C(F)(F)C1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C9H13F2NO2/c1-5(2)9(10,11)6-3-7(13)12-8(14)4-6/h5-6H,3-4H2,1-2H3,(H,12,13,14) |
| InChIKey | SLILCEVTLFLCTP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.20 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|