C24H26FN7O2 — CID 169029086
(2S,3S)-3-[[7-(dimethylamino)-2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid (PubChem CID 169029086) has the molecular formula C24H26FN7O2 and a molecular weight of 463.52 g/mol. Its IUPAC name is (2S,3S)-3-[[7-(dimethylamino)-2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid.
| Compound Name | (2S,3S)-3-[[7-(dimethylamino)-2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 169029086 |
| Molecular Formula | C24H26FN7O2 |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | (2S,3S)-3-[[7-(dimethylamino)-2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid |
| SMILES | CN(C)c1ccc2c(N[C@H]3C4CCC(CC4)[C@@H]3C(=O)O)nc(-c3c[nH]c4ncc(F)cc34)nn12 |
| InChI | InChI=1S/C24H26FN7O2/c1-31(2)18-8-7-17-23(28-20-13-5-3-12(4-6-13)19(20)24(33)34)29-22(30-32(17)18)16-11-27-21-15(16)9-14(25)10-26-21/h7-13,19-20H,3-6H2,1-2H3,(H,26,27)(H,33,34)(H,28,29,30)/t12?,13?,19-,20-/m0/s1 |
| InChIKey | NUNMJHNZERWUNC-JFFVOTQRSA-N |
| XLogP | 3.78 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |