C24H26FN7O2 — CID 175895881
(2R,3R)-3-[[2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-7-(methylaminomethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid (PubChem CID 175895881) has the molecular formula C24H26FN7O2 and a molecular weight of 463.52 g/mol. Its IUPAC name is (2R,3R)-3-[[2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-7-(methylaminomethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid.
| Compound Name | (2R,3R)-3-[[2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-7-(methylaminomethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 175895881 |
| Molecular Formula | C24H26FN7O2 |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | (2R,3R)-3-[[2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-7-(methylaminomethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid |
| SMILES | CNCc1ccc2c(N[C@@H]3C4CCC(CC4)[C@H]3C(=O)O)nc(-c3c[nH]c4ncc(F)cc34)nn12 |
| InChI | InChI=1S/C24H26FN7O2/c1-26-10-15-6-7-18-23(29-20-13-4-2-12(3-5-13)19(20)24(33)34)30-22(31-32(15)18)17-11-28-21-16(17)8-14(25)9-27-21/h6-9,11-13,19-20,26H,2-5,10H2,1H3,(H,27,28)(H,33,34)(H,29,30,31)/t12?,13?,19-,20-/m1/s1 |
| InChIKey | KBRJUBRHYFFOIC-ZACCDXADSA-N |
| XLogP | 3.43 |
| TPSA | 120.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |