C42H48N4OPt — CID 169030590
[1-[3-tert-butyl-5-[5-(4-methyl-2-pyridinyl)spiro[6a,7,8,9,10,10a-hexahydrophenanthridine-6,1'-cyclohexane]-3-yl]oxyphenyl]-3-methylbenzimidazol-2-ylidene]platinum (PubChem CID 169030590) has the molecular formula C42H48N4OPt and a molecular weight of 819.95 g/mol. Its IUPAC name is [1-[3-tert-butyl-5-[5-(4-methyl-2-pyridinyl)spiro[6a,7,8,9,10,10a-hexahydrophenanthridine-6,1'-cyclohexane]-3-yl]oxyphenyl]-3-methylbenzimidazol-2-ylidene]platinum.
| Compound Name | [1-[3-tert-butyl-5-[5-(4-methyl-2-pyridinyl)spiro[6a,7,8,9,10,10a-hexahydrophenanthridine-6,1'-cyclohexane]-3-yl]oxyphenyl]-3-methylbenzimidazol-2-ylidene]platinum |
|---|---|
| PubChem CID | 169030590 |
| Molecular Formula | C42H48N4OPt |
| Molecular Weight | 819.95 g/mol |
| Exact Mass | 819.35 |
| IUPAC Name | [1-[3-tert-butyl-5-[5-(4-methyl-2-pyridinyl)spiro[6a,7,8,9,10,10a-hexahydrophenanthridine-6,1'-cyclohexane]-3-yl]oxyphenyl]-3-methylbenzimidazol-2-ylidene]platinum |
| SMILES | Cc1ccnc(N2c3cc(Oc4cc(-n5c(=[Pt])n(C)c6ccccc65)cc(C(C)(C)C)c4)ccc3C3CCCCC3C23CCCCC3)c1 |
| InChI | InChI=1S/C42H48N4O.Pt/c1-29-19-22-43-40(23-29)46-39-27-32(17-18-35(39)34-13-7-8-14-36(34)42(46)20-11-6-12-21-42)47-33-25-30(41(2,3)4)24-31(26-33)45-28-44(5)37-15-9-10-16-38(37)45;/h9-10,15-19,22-27,34,36H,6-8,11-14,20-21H2,1-5H3; |
| InChIKey | VWRHOGOADZYNIV-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 35.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.95 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |