C53H48N4OPt — CID 169030595
[1-[3-[[5-(4-tert-butyl-2-pyridinyl)-6a,7,8,9,10,10a-hexahydro-6H-phenanthridin-3-yl]oxy]phenyl]-3-(2,6-diphenylphenyl)benzimidazol-2-ylidene]platinum (PubChem CID 169030595) has the molecular formula C53H48N4OPt and a molecular weight of 952.07 g/mol. Its IUPAC name is [1-[3-[[5-(4-tert-butyl-2-pyridinyl)-6a,7,8,9,10,10a-hexahydro-6H-phenanthridin-3-yl]oxy]phenyl]-3-(2,6-diphenylphenyl)benzimidazol-2-ylidene]platinum.
| Compound Name | [1-[3-[[5-(4-tert-butyl-2-pyridinyl)-6a,7,8,9,10,10a-hexahydro-6H-phenanthridin-3-yl]oxy]phenyl]-3-(2,6-diphenylphenyl)benzimidazol-2-ylidene]platinum |
|---|---|
| PubChem CID | 169030595 |
| Molecular Formula | C53H48N4OPt |
| Molecular Weight | 952.07 g/mol |
| Exact Mass | 951.35 |
| IUPAC Name | [1-[3-[[5-(4-tert-butyl-2-pyridinyl)-6a,7,8,9,10,10a-hexahydro-6H-phenanthridin-3-yl]oxy]phenyl]-3-(2,6-diphenylphenyl)benzimidazol-2-ylidene]platinum |
| SMILES | CC(C)(C)c1ccnc(N2CC3CCCCC3c3ccc(Oc4cccc(-n5c(=[Pt])n(-c6c(-c7ccccc7)cccc6-c6ccccc6)c6ccccc65)c4)cc32)c1 |
| InChI | InChI=1S/C53H48N4O.Pt/c1-53(2,3)40-30-31-54-51(32-40)55-35-39-20-10-11-23-44(39)47-29-28-43(34-50(47)55)58-42-22-14-21-41(33-42)56-36-57(49-27-13-12-26-48(49)56)52-45(37-16-6-4-7-17-37)24-15-25-46(52)38-18-8-5-9-19-38;/h4-9,12-19,21-22,24-34,39,44H,10-11,20,23,35H2,1-3H3; |
| InChIKey | PVNIYFFSZQHXCD-UHFFFAOYSA-N |
| XLogP | 13.74 |
| TPSA | 35.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 952.07 |
| LogP ≤ 5 | 13.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |