C54H52N4OPt — CID 169066426
[1-[3-[[1-(4-tert-butyl-2-pyridinyl)-4,4-dimethyl-2,3-dihydroquinolin-7-yl]oxy]phenyl]-3-(3,4,5-trimethyl-2,6-diphenylphenyl)benzimidazol-2-ylidene]platinum (PubChem CID 169066426) has the molecular formula C54H52N4OPt and a molecular weight of 968.11 g/mol. Its IUPAC name is [1-[3-[[1-(4-tert-butyl-2-pyridinyl)-4,4-dimethyl-2,3-dihydroquinolin-7-yl]oxy]phenyl]-3-(3,4,5-trimethyl-2,6-diphenylphenyl)benzimidazol-2-ylidene]platinum.
| Compound Name | [1-[3-[[1-(4-tert-butyl-2-pyridinyl)-4,4-dimethyl-2,3-dihydroquinolin-7-yl]oxy]phenyl]-3-(3,4,5-trimethyl-2,6-diphenylphenyl)benzimidazol-2-ylidene]platinum |
|---|---|
| PubChem CID | 169066426 |
| Molecular Formula | C54H52N4OPt |
| Molecular Weight | 968.11 g/mol |
| Exact Mass | 967.38 |
| IUPAC Name | [1-[3-[[1-(4-tert-butyl-2-pyridinyl)-4,4-dimethyl-2,3-dihydroquinolin-7-yl]oxy]phenyl]-3-(3,4,5-trimethyl-2,6-diphenylphenyl)benzimidazol-2-ylidene]platinum |
| SMILES | Cc1c(C)c(-c2ccccc2)c(-n2c(=[Pt])n(-c3cccc(Oc4ccc5c(c4)N(c4cc(C(C)(C)C)ccn4)CCC5(C)C)c3)c3ccccc32)c(-c2ccccc2)c1C |
| InChI | InChI=1S/C54H52N4O.Pt/c1-36-37(2)50(39-18-11-9-12-19-39)52(51(38(36)3)40-20-13-10-14-21-40)58-35-57(46-24-15-16-25-47(46)58)42-22-17-23-43(33-42)59-44-26-27-45-48(34-44)56(31-29-54(45,7)8)49-32-41(28-30-55-49)53(4,5)6;/h9-28,30,32-34H,29,31H2,1-8H3; |
| InChIKey | XXZUQIDRNJHCFO-UHFFFAOYSA-N |
| XLogP | 14.06 |
| TPSA | 35.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 968.11 |
| LogP ≤ 5 | 14.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |