5-bromo-2-fluoropyridine-3-carbonyl fluoride

C6H2BrF2NO — CID 169030811

IUPAC5-bromo-2-fluoropyridine-3-carbonyl fluoride
SMILESO=C(F)c1cc(Br)cnc1F
InChIInChI=1S/C6H2BrF2NO/c7-3-1-4(6(9)11)5(8)10-2-3/h1-2H
InChIKeyZZORLPHJVNLCLT-UHFFFAOYSA-N
MW221.99 g/mol
LogP2.09
Rot. Bonds1

About 5-bromo-2-fluoropyridine-3-carbonyl fluoride

5-bromo-2-fluoropyridine-3-carbonyl fluoride (PubChem CID 169030811) has the molecular formula C6H2BrF2NO and a molecular weight of 221.99 g/mol. Its IUPAC name is 5-bromo-2-fluoropyridine-3-carbonyl fluoride.

Molecular Properties

Compound Name5-bromo-2-fluoropyridine-3-carbonyl fluoride
PubChem CID169030811
Molecular FormulaC6H2BrF2NO
Molecular Weight221.99 g/mol
Exact Mass220.93
IUPAC Name5-bromo-2-fluoropyridine-3-carbonyl fluoride
SMILESO=C(F)c1cc(Br)cnc1F
InChIInChI=1S/C6H2BrF2NO/c7-3-1-4(6(9)11)5(8)10-2-3/h1-2H
InChIKeyZZORLPHJVNLCLT-UHFFFAOYSA-N
XLogP2.09
TPSA29.96 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.99
LogP ≤ 52.09
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 5-bromo-2-fluoropyridine-3-carbonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-bromo-2-fluoropyridine-3-carbonyl fluoride?
The IUPAC name of 5-bromo-2-fluoropyridine-3-carbonyl fluoride (CID 169030811) is 5-bromo-2-fluoropyridine-3-carbonyl fluoride.
What is the SMILES notation for 5-bromo-2-fluoropyridine-3-carbonyl fluoride?
The canonical SMILES for 5-bromo-2-fluoropyridine-3-carbonyl fluoride is O=C(F)c1cc(Br)cnc1F.
What is the InChIKey of 5-bromo-2-fluoropyridine-3-carbonyl fluoride?
The InChIKey is ZZORLPHJVNLCLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2BrF2NO/c7-3-1-4(6(9)11)5(8)10-2-3/h1-2H.
What are the key properties of 5-bromo-2-fluoropyridine-3-carbonyl fluoride?
5-bromo-2-fluoropyridine-3-carbonyl fluoride has a molecular weight of 221.99 g/mol, XLogP of 2.09, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-fluoropyridine-3-carbonyl fluoride is sourced from PubChem (CID 169030811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).