C15H16BrF3N2O2 — CID 169030957
3-[5-(2-bromoethoxy)-7-(trifluoromethyl)benzimidazol-1-yl]-1-methylcyclobutan-1-ol (PubChem CID 169030957) has the molecular formula C15H16BrF3N2O2 and a molecular weight of 393.20 g/mol. Its IUPAC name is 3-[5-(2-bromoethoxy)-7-(trifluoromethyl)benzimidazol-1-yl]-1-methylcyclobutan-1-ol.
| Compound Name | 3-[5-(2-bromoethoxy)-7-(trifluoromethyl)benzimidazol-1-yl]-1-methylcyclobutan-1-ol |
|---|---|
| PubChem CID | 169030957 |
| Molecular Formula | C15H16BrF3N2O2 |
| Molecular Weight | 393.20 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | 3-[5-(2-bromoethoxy)-7-(trifluoromethyl)benzimidazol-1-yl]-1-methylcyclobutan-1-ol |
| SMILES | CC1(O)CC(n2cnc3cc(OCCBr)cc(C(F)(F)F)c32)C1 |
| InChI | InChI=1S/C15H16BrF3N2O2/c1-14(22)6-9(7-14)21-8-20-12-5-10(23-3-2-16)4-11(13(12)21)15(17,18)19/h4-5,8-9,22H,2-3,6-7H2,1H3 |
| InChIKey | RHSVRLFNGZGMQM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.20 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|