C17H19F3N2O3S — CID 170121616
1-(3-hydroxy-3-methylcyclobutyl)-6-(2-methylsulfanylethoxy)-8-(trifluoromethyl)quinoxalin-2-one (PubChem CID 170121616) has the molecular formula C17H19F3N2O3S and a molecular weight of 388.41 g/mol. Its IUPAC name is 1-(3-hydroxy-3-methylcyclobutyl)-6-(2-methylsulfanylethoxy)-8-(trifluoromethyl)quinoxalin-2-one.
| Compound Name | 1-(3-hydroxy-3-methylcyclobutyl)-6-(2-methylsulfanylethoxy)-8-(trifluoromethyl)quinoxalin-2-one |
|---|---|
| PubChem CID | 170121616 |
| Molecular Formula | C17H19F3N2O3S |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 1-(3-hydroxy-3-methylcyclobutyl)-6-(2-methylsulfanylethoxy)-8-(trifluoromethyl)quinoxalin-2-one |
| SMILES | CSCCOc1cc(C(F)(F)F)c2c(c1)ncc(=O)n2C1CC(C)(O)C1 |
| InChI | InChI=1S/C17H19F3N2O3S/c1-16(24)7-10(8-16)22-14(23)9-21-13-6-11(25-3-4-26-2)5-12(15(13)22)17(18,19)20/h5-6,9-10,24H,3-4,7-8H2,1-2H3 |
| InChIKey | KMOXAESOPLDIKA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|