C22H25N7O4S — CID 16903111
(Z)-N-[2-(6-ethylsulfanyl-4-morpholin-4-ylpyrazolo[5,4-d]pyrimidin-1-yl)ethyl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 16903111) has the molecular formula C22H25N7O4S and a molecular weight of 483.55 g/mol. Its IUPAC name is (Z)-N-[2-(6-ethylsulfanyl-4-morpholin-4-ylpyrazolo[5,4-d]pyrimidin-1-yl)ethyl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-N-[2-(6-ethylsulfanyl-4-morpholin-4-ylpyrazolo[5,4-d]pyrimidin-1-yl)ethyl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 16903111 |
| Molecular Formula | C22H25N7O4S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | (Z)-N-[2-(6-ethylsulfanyl-4-morpholin-4-ylpyrazolo[5,4-d]pyrimidin-1-yl)ethyl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | CCSc1nc(N2CCOCC2)c2cnn(CCNC(=O)/C=C\c3ccc([N+](=O)[O-])cc3)c2n1 |
| InChI | InChI=1S/C22H25N7O4S/c1-2-34-22-25-20(27-11-13-33-14-12-27)18-15-24-28(21(18)26-22)10-9-23-19(30)8-5-16-3-6-17(7-4-16)29(31)32/h3-8,15H,2,9-14H2,1H3,(H,23,30)/b8-5- |
| InChIKey | UHHUTMMYYPCLBY-YVMONPNESA-N |
| XLogP | 2.51 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|