C22H27N7O4S — CID 16904219
2-methyl-N-[2-(4-morpholin-4-yl-6-propylsulfanylpyrazolo[5,4-d]pyrimidin-1-yl)ethyl]-3-nitrobenzamide (PubChem CID 16904219) has the molecular formula C22H27N7O4S and a molecular weight of 485.57 g/mol. Its IUPAC name is 2-methyl-N-[2-(4-morpholin-4-yl-6-propylsulfanylpyrazolo[5,4-d]pyrimidin-1-yl)ethyl]-3-nitrobenzamide.
| Compound Name | 2-methyl-N-[2-(4-morpholin-4-yl-6-propylsulfanylpyrazolo[5,4-d]pyrimidin-1-yl)ethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 16904219 |
| Molecular Formula | C22H27N7O4S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 2-methyl-N-[2-(4-morpholin-4-yl-6-propylsulfanylpyrazolo[5,4-d]pyrimidin-1-yl)ethyl]-3-nitrobenzamide |
| SMILES | CCCSc1nc(N2CCOCC2)c2cnn(CCNC(=O)c3cccc([N+](=O)[O-])c3C)c2n1 |
| InChI | InChI=1S/C22H27N7O4S/c1-3-13-34-22-25-19(27-9-11-33-12-10-27)17-14-24-28(20(17)26-22)8-7-23-21(30)16-5-4-6-18(15(16)2)29(31)32/h4-6,14H,3,7-13H2,1-2H3,(H,23,30) |
| InChIKey | YRQDQKYCQMMBTG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|