C21H25N7O3S — CID 16904071
3-nitro-N-[2-(6-propylsulfanyl-4-pyrrolidin-1-ylpyrazolo[5,4-d]pyrimidin-1-yl)ethyl]benzamide (PubChem CID 16904071) has the molecular formula C21H25N7O3S and a molecular weight of 455.54 g/mol. Its IUPAC name is 3-nitro-N-[2-(6-propylsulfanyl-4-pyrrolidin-1-ylpyrazolo[5,4-d]pyrimidin-1-yl)ethyl]benzamide.
| Compound Name | 3-nitro-N-[2-(6-propylsulfanyl-4-pyrrolidin-1-ylpyrazolo[5,4-d]pyrimidin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 16904071 |
| Molecular Formula | C21H25N7O3S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 3-nitro-N-[2-(6-propylsulfanyl-4-pyrrolidin-1-ylpyrazolo[5,4-d]pyrimidin-1-yl)ethyl]benzamide |
| SMILES | CCCSc1nc(N2CCCC2)c2cnn(CCNC(=O)c3cccc([N+](=O)[O-])c3)c2n1 |
| InChI | InChI=1S/C21H25N7O3S/c1-2-12-32-21-24-18(26-9-3-4-10-26)17-14-23-27(19(17)25-21)11-8-22-20(29)15-6-5-7-16(13-15)28(30)31/h5-7,13-14H,2-4,8-12H2,1H3,(H,22,29) |
| InChIKey | WVHCSOXRAOAVMI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|