C22H27N7O3S — CID 16905098
4-nitro-N-[2-(4-piperidin-1-yl-6-propan-2-ylsulfanylpyrazolo[5,4-d]pyrimidin-1-yl)ethyl]benzamide (PubChem CID 16905098) has the molecular formula C22H27N7O3S and a molecular weight of 469.57 g/mol. Its IUPAC name is 4-nitro-N-[2-(4-piperidin-1-yl-6-propan-2-ylsulfanylpyrazolo[5,4-d]pyrimidin-1-yl)ethyl]benzamide.
| Compound Name | 4-nitro-N-[2-(4-piperidin-1-yl-6-propan-2-ylsulfanylpyrazolo[5,4-d]pyrimidin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 16905098 |
| Molecular Formula | C22H27N7O3S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 4-nitro-N-[2-(4-piperidin-1-yl-6-propan-2-ylsulfanylpyrazolo[5,4-d]pyrimidin-1-yl)ethyl]benzamide |
| SMILES | CC(C)Sc1nc(N2CCCCC2)c2cnn(CCNC(=O)c3ccc([N+](=O)[O-])cc3)c2n1 |
| InChI | InChI=1S/C22H27N7O3S/c1-15(2)33-22-25-19(27-11-4-3-5-12-27)18-14-24-28(20(18)26-22)13-10-23-21(30)16-6-8-17(9-7-16)29(31)32/h6-9,14-15H,3-5,10-13H2,1-2H3,(H,23,30) |
| InChIKey | ZNOXMIMJOSGDSL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|