C20H22ClN7O3S — CID 16901573
2-chloro-N-[2-(6-methylsulfanyl-4-piperidin-1-ylpyrazolo[5,4-d]pyrimidin-1-yl)ethyl]-5-nitrobenzamide (PubChem CID 16901573) has the molecular formula C20H22ClN7O3S and a molecular weight of 475.96 g/mol. Its IUPAC name is 2-chloro-N-[2-(6-methylsulfanyl-4-piperidin-1-ylpyrazolo[5,4-d]pyrimidin-1-yl)ethyl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[2-(6-methylsulfanyl-4-piperidin-1-ylpyrazolo[5,4-d]pyrimidin-1-yl)ethyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 16901573 |
| Molecular Formula | C20H22ClN7O3S |
| Molecular Weight | 475.96 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 2-chloro-N-[2-(6-methylsulfanyl-4-piperidin-1-ylpyrazolo[5,4-d]pyrimidin-1-yl)ethyl]-5-nitrobenzamide |
| SMILES | CSc1nc(N2CCCCC2)c2cnn(CCNC(=O)c3cc([N+](=O)[O-])ccc3Cl)c2n1 |
| InChI | InChI=1S/C20H22ClN7O3S/c1-32-20-24-17(26-8-3-2-4-9-26)15-12-23-27(18(15)25-20)10-7-22-19(29)14-11-13(28(30)31)5-6-16(14)21/h5-6,11-12H,2-4,7-10H2,1H3,(H,22,29) |
| InChIKey | JSEYYHCABCPIIS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.96 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|