C15H16ClN3O3S — CID 169032492
5-chloro-7-morpholin-4-yl-N-(oxetan-3-yl)thieno[3,2-b]pyridine-2-carboxamide (PubChem CID 169032492) has the molecular formula C15H16ClN3O3S and a molecular weight of 353.83 g/mol. Its IUPAC name is 5-chloro-7-morpholin-4-yl-N-(oxetan-3-yl)thieno[3,2-b]pyridine-2-carboxamide.
| Compound Name | 5-chloro-7-morpholin-4-yl-N-(oxetan-3-yl)thieno[3,2-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 169032492 |
| Molecular Formula | C15H16ClN3O3S |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 5-chloro-7-morpholin-4-yl-N-(oxetan-3-yl)thieno[3,2-b]pyridine-2-carboxamide |
| SMILES | O=C(NC1COC1)c1cc2nc(Cl)cc(N3CCOCC3)c2s1 |
| InChI | InChI=1S/C15H16ClN3O3S/c16-13-6-11(19-1-3-21-4-2-19)14-10(18-13)5-12(23-14)15(20)17-9-7-22-8-9/h5-6,9H,1-4,7-8H2,(H,17,20) |
| InChIKey | YQEQGCVUPYAUCG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|