C9H12F2N2O2S — CID 169034286
3,3-difluoro-N-methyl-3-pyridin-2-ylsulfonylpropan-1-amine (PubChem CID 169034286) has the molecular formula C9H12F2N2O2S and a molecular weight of 250.27 g/mol. Its IUPAC name is 3,3-difluoro-N-methyl-3-pyridin-2-ylsulfonylpropan-1-amine.
| Compound Name | 3,3-difluoro-N-methyl-3-pyridin-2-ylsulfonylpropan-1-amine |
|---|---|
| PubChem CID | 169034286 |
| Molecular Formula | C9H12F2N2O2S |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 3,3-difluoro-N-methyl-3-pyridin-2-ylsulfonylpropan-1-amine |
| SMILES | CNCCC(F)(F)S(=O)(=O)c1ccccn1 |
| InChI | InChI=1S/C9H12F2N2O2S/c1-12-7-5-9(10,11)16(14,15)8-4-2-3-6-13-8/h2-4,6,12H,5,7H2,1H3 |
| InChIKey | PDNSVBYRWVWFHX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |