C8H8F2INO2S — CID 169034295
2-(1,1-difluoro-3-iodopropyl)sulfonylpyridine (PubChem CID 169034295) has the molecular formula C8H8F2INO2S and a molecular weight of 347.12 g/mol. Its IUPAC name is 2-(1,1-difluoro-3-iodopropyl)sulfonylpyridine.
| Compound Name | 2-(1,1-difluoro-3-iodopropyl)sulfonylpyridine |
|---|---|
| PubChem CID | 169034295 |
| Molecular Formula | C8H8F2INO2S |
| Molecular Weight | 347.12 g/mol |
| Exact Mass | 346.93 |
| IUPAC Name | 2-(1,1-difluoro-3-iodopropyl)sulfonylpyridine |
| SMILES | O=S(=O)(c1ccccn1)C(F)(F)CCI |
| InChI | InChI=1S/C8H8F2INO2S/c9-8(10,4-5-11)15(13,14)7-3-1-2-6-12-7/h1-3,6H,4-5H2 |
| InChIKey | PPQDTKPXLGBRAN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.12 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|