C51H46N2 — CID 169037156
3-[9-(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)-7,8-dihydrocarbazol-3-yl]-9-(9,9-dimethyl-4a,9a-dihydrofluoren-1-yl)-2,3-dihydrocarbazole (PubChem CID 169037156) has the molecular formula C51H46N2 and a molecular weight of 686.94 g/mol. Its IUPAC name is 3-[9-(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)-7,8-dihydrocarbazol-3-yl]-9-(9,9-dimethyl-4a,9a-dihydrofluoren-1-yl)-2,3-dihydrocarbazole.
| Compound Name | 3-[9-(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)-7,8-dihydrocarbazol-3-yl]-9-(9,9-dimethyl-4a,9a-dihydrofluoren-1-yl)-2,3-dihydrocarbazole |
|---|---|
| PubChem CID | 169037156 |
| Molecular Formula | C51H46N2 |
| Molecular Weight | 686.94 g/mol |
| Exact Mass | 686.37 |
| IUPAC Name | 3-[9-(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)-7,8-dihydrocarbazol-3-yl]-9-(9,9-dimethyl-4a,9a-dihydrofluoren-1-yl)-2,3-dihydrocarbazole |
| SMILES | CC1(C)c2ccccc2C2C=CC=C(n3c4c(c5ccccc53)=CC(c3ccc5c(c3)c3c(n5C5=CC=C(C6=CC=CCC6)CC5)CCC=C3)CC=4)C21 |
| InChI | InChI=1S/C51H46N2/c1-51(2)44-19-9-6-15-38(44)41-18-12-22-49(50(41)51)53-46-21-11-8-17-40(46)43-32-36(26-30-48(43)53)35-25-29-47-42(31-35)39-16-7-10-20-45(39)52(47)37-27-23-34(24-28-37)33-13-4-3-5-14-33/h3-4,6-9,11-13,15-19,21-23,25,27,29-32,36,41,50H,5,10,14,20,24,26,28H2,1-2H3 |
| InChIKey | IVONMKXJSIBDDX-UHFFFAOYSA-N |
| XLogP | 11.24 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.94 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |