C47H46N2 — CID 174103942
6-[9-[(2R,6R)-2-cyclohexa-1,3-dien-1-yl-6-methylcyclohex-3-en-1-yl]-2,3,7,8-tetrahydrocarbazol-3-yl]-9-[(2S)-2,3-dihydronaphthalen-2-yl]-1,2-dihydrocarbazole (PubChem CID 174103942) has the molecular formula C47H46N2 and a molecular weight of 638.90 g/mol. Its IUPAC name is 6-[9-[(2R,6R)-2-cyclohexa-1,3-dien-1-yl-6-methylcyclohex-3-en-1-yl]-2,3,7,8-tetrahydrocarbazol-3-yl]-9-[(2S)-2,3-dihydronaphthalen-2-yl]-1,2-dihydrocarbazole.
| Compound Name | 6-[9-[(2R,6R)-2-cyclohexa-1,3-dien-1-yl-6-methylcyclohex-3-en-1-yl]-2,3,7,8-tetrahydrocarbazol-3-yl]-9-[(2S)-2,3-dihydronaphthalen-2-yl]-1,2-dihydrocarbazole |
|---|---|
| PubChem CID | 174103942 |
| Molecular Formula | C47H46N2 |
| Molecular Weight | 638.90 g/mol |
| Exact Mass | 638.37 |
| IUPAC Name | 6-[9-[(2R,6R)-2-cyclohexa-1,3-dien-1-yl-6-methylcyclohex-3-en-1-yl]-2,3,7,8-tetrahydrocarbazol-3-yl]-9-[(2S)-2,3-dihydronaphthalen-2-yl]-1,2-dihydrocarbazole |
| SMILES | C[C@@H]1CC=C[C@H](C2=CC=CCC2)C1n1c2c(c3c1=CCC(c1ccc4c(c1)c1c(n4[C@@H]4C=c5ccccc5=CC4)CCC=C1)C=3)C=CCC2 |
| InChI | InChI=1S/C47H46N2/c1-31-12-11-19-38(33-14-3-2-4-15-33)47(31)49-44-21-10-8-18-40(44)42-30-36(24-27-46(42)49)35-23-26-45-41(29-35)39-17-7-9-20-43(39)48(45)37-25-22-32-13-5-6-16-34(32)28-37/h2-3,5-8,11,13-14,16-19,22-23,26-31,36-38,47H,4,9-10,12,15,20-21,24-25H2,1H3/t31-,36?,37+,38-,47?/m1/s1 |
| InChIKey | VEJCLLCLXUCDCZ-ZIJLWJDGSA-N |
| XLogP | 8.35 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.90 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|